C7H13N2O2+ — CID 163902878
(1-methyl-2-oxabicyclo[2.1.1]hexan-4-yl)carbamoylazanium (PubChem CID 163902878) has the molecular formula C7H13N2O2+ and a molecular weight of 157.19 g/mol. Its IUPAC name is (1-methyl-2-oxabicyclo[2.1.1]hexan-4-yl)carbamoylazanium.
| Compound Name | (1-methyl-2-oxabicyclo[2.1.1]hexan-4-yl)carbamoylazanium |
|---|---|
| PubChem CID | 163902878 |
| Molecular Formula | C7H13N2O2+ |
| Molecular Weight | 157.19 g/mol |
| Exact Mass | 157.10 |
| IUPAC Name | (1-methyl-2-oxabicyclo[2.1.1]hexan-4-yl)carbamoylazanium |
| SMILES | CC12CC(NC([NH3+])=O)(CO1)C2 |
| InChI | InChI=1S/C7H12N2O2/c1-6-2-7(3-6,4-11-6)9-5(8)10/h2-4H2,1H3,(H3,8,9,10)/p+1 |
| InChIKey | QLJYROGVMRGAOS-UHFFFAOYSA-O |
| XLogP | -0.74 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.19 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |