C56H54N2O3S — CID 163903944
2-[6-[4-[2-(3-carbazol-9-yl-2-hydroxy-5-methylphenyl)phenoxy]butylsulfanyl]-6-methylcyclohex-2-en-1-yl]-4-methyl-6-(3-methyl-3,4-dihydrocarbazol-9-yl)phenol (PubChem CID 163903944) has the molecular formula C56H54N2O3S and a molecular weight of 835.13 g/mol. Its IUPAC name is 2-[6-[4-[2-(3-carbazol-9-yl-2-hydroxy-5-methylphenyl)phenoxy]butylsulfanyl]-6-methylcyclohex-2-en-1-yl]-4-methyl-6-(3-methyl-3,4-dihydrocarbazol-9-yl)phenol.
| Compound Name | 2-[6-[4-[2-(3-carbazol-9-yl-2-hydroxy-5-methylphenyl)phenoxy]butylsulfanyl]-6-methylcyclohex-2-en-1-yl]-4-methyl-6-(3-methyl-3,4-dihydrocarbazol-9-yl)phenol |
|---|---|
| PubChem CID | 163903944 |
| Molecular Formula | C56H54N2O3S |
| Molecular Weight | 835.13 g/mol |
| Exact Mass | 834.39 |
| IUPAC Name | 2-[6-[4-[2-(3-carbazol-9-yl-2-hydroxy-5-methylphenyl)phenoxy]butylsulfanyl]-6-methylcyclohex-2-en-1-yl]-4-methyl-6-(3-methyl-3,4-dihydrocarbazol-9-yl)phenol |
| SMILES | Cc1cc(C2C=CCCC2(C)SCCCCOc2ccccc2-c2cc(C)cc(-n3c4ccccc4c4ccccc43)c2O)c(O)c(-n2c3c(c4ccccc42)CC(C)C=C3)c1 |
| InChI | InChI=1S/C56H54N2O3S/c1-36-26-27-50-43(31-36)41-19-7-11-24-49(41)58(50)52-35-38(3)33-45(55(52)60)46-21-13-14-28-56(46,4)62-30-16-15-29-61-53-25-12-8-20-42(53)44-32-37(2)34-51(54(44)59)57-47-22-9-5-17-39(47)40-18-6-10-23-48(40)57/h5-13,17-27,32-36,46,59-60H,14-16,28-31H2,1-4H3 |
| InChIKey | QMGPYZWXPVGZGT-UHFFFAOYSA-N |
| XLogP | 14.41 |
| TPSA | 59.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.13 |
| LogP ≤ 5 | 14.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|