C60H36N4U — CID 163908236
2-[3,5-di(phenanthren-9-yl)phenyl]-4-(3-phenylbenzene-4-id-1-yl)-6-(4-pyridin-3-ylphenyl)-1,3,5-triazine;uranium(2+) (PubChem CID 163908236) has the molecular formula C60H36N4U and a molecular weight of 1051.01 g/mol. Its IUPAC name is 2-[3,5-di(phenanthren-9-yl)phenyl]-4-(3-phenylbenzene-4-id-1-yl)-6-(4-pyridin-3-ylphenyl)-1,3,5-triazine;uranium(2+).
| Compound Name | 2-[3,5-di(phenanthren-9-yl)phenyl]-4-(3-phenylbenzene-4-id-1-yl)-6-(4-pyridin-3-ylphenyl)-1,3,5-triazine;uranium(2+) |
|---|---|
| PubChem CID | 163908236 |
| Molecular Formula | C60H36N4U |
| Molecular Weight | 1051.01 g/mol |
| Exact Mass | 1050.34 |
| IUPAC Name | 2-[3,5-di(phenanthren-9-yl)phenyl]-4-(3-phenylbenzene-4-id-1-yl)-6-(4-pyridin-3-ylphenyl)-1,3,5-triazine;uranium(2+) |
| SMILES | [U+2].[c-]1ccccc1-c1[c-]ccc(-c2nc(-c3ccc(-c4cccnc4)cc3)nc(-c3cc(-c4cc5ccccc5c5ccccc45)cc(-c4cc5ccccc5c5ccccc45)c3)n2)c1 |
| InChI | InChI=1S/C60H36N4.U/c1-2-14-39(15-3-1)42-18-12-19-45(32-42)59-62-58(41-29-27-40(28-30-41)46-20-13-31-61-38-46)63-60(64-59)49-34-47(56-36-43-16-4-6-21-50(43)52-23-8-10-25-54(52)56)33-48(35-49)57-37-44-17-5-7-22-51(44)53-24-9-11-26-55(53)57;/h1-14,16-17,19-38H;/q-2;+2 |
| InChIKey | PJSIRRRQWSFSHQ-UHFFFAOYSA-N |
| XLogP | 15.15 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1051.01 |
| LogP ≤ 5 | 15.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|