C9H16N4O — CID 163910569
N-piperidin-4-yl-2,3-dihydro-1H-imidazole-4-carboxamide (PubChem CID 163910569) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is N-piperidin-4-yl-2,3-dihydro-1H-imidazole-4-carboxamide.
| Compound Name | N-piperidin-4-yl-2,3-dihydro-1H-imidazole-4-carboxamide |
|---|---|
| PubChem CID | 163910569 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | N-piperidin-4-yl-2,3-dihydro-1H-imidazole-4-carboxamide |
| SMILES | O=C(NC1CCNCC1)C1=CNCN1 |
| InChI | InChI=1S/C9H16N4O/c14-9(8-5-11-6-12-8)13-7-1-3-10-4-2-7/h5,7,10-12H,1-4,6H2,(H,13,14) |
| InChIKey | OUZMMANZPPAMLF-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |