C15H19N3OS2 — CID 163910692
6-(4-methylcyclohexyl)-2-sulfanylidene-5-(1,3-thiazol-2-ylmethyl)-1H-pyrimidin-4-one (PubChem CID 163910692) has the molecular formula C15H19N3OS2 and a molecular weight of 321.47 g/mol. Its IUPAC name is 6-(4-methylcyclohexyl)-2-sulfanylidene-5-(1,3-thiazol-2-ylmethyl)-1H-pyrimidin-4-one.
| Compound Name | 6-(4-methylcyclohexyl)-2-sulfanylidene-5-(1,3-thiazol-2-ylmethyl)-1H-pyrimidin-4-one |
|---|---|
| PubChem CID | 163910692 |
| Molecular Formula | C15H19N3OS2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 6-(4-methylcyclohexyl)-2-sulfanylidene-5-(1,3-thiazol-2-ylmethyl)-1H-pyrimidin-4-one |
| SMILES | CC1CCC(c2[nH]c(=S)[nH]c(=O)c2Cc2nccs2)CC1 |
| InChI | InChI=1S/C15H19N3OS2/c1-9-2-4-10(5-3-9)13-11(8-12-16-6-7-21-12)14(19)18-15(20)17-13/h6-7,9-10H,2-5,8H2,1H3,(H2,17,18,19,20) |
| InChIKey | QRUSOVQMBMZXMW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|