C15H25FN2O3 — CID 163914247
tert-butyl (4R)-4-fluoro-2-(pent-4-en-2-ylcarbamoyl)pyrrolidine-1-carboxylate (PubChem CID 163914247) has the molecular formula C15H25FN2O3 and a molecular weight of 300.37 g/mol. Its IUPAC name is tert-butyl (4R)-4-fluoro-2-(pent-4-en-2-ylcarbamoyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (4R)-4-fluoro-2-(pent-4-en-2-ylcarbamoyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 163914247 |
| Molecular Formula | C15H25FN2O3 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | tert-butyl (4R)-4-fluoro-2-(pent-4-en-2-ylcarbamoyl)pyrrolidine-1-carboxylate |
| SMILES | C=CCC(C)NC(=O)C1C[C@@H](F)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H25FN2O3/c1-6-7-10(2)17-13(19)12-8-11(16)9-18(12)14(20)21-15(3,4)5/h6,10-12H,1,7-9H2,2-5H3,(H,17,19)/t10?,11-,12?/m1/s1 |
| InChIKey | QUVQHIHAFXMZEH-MOENNCHZSA-N |
| XLogP | 2.41 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|