C18H25NO4 — CID 163914436
methyl (E)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylpent-4-enoate (PubChem CID 163914436) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is methyl (E)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylpent-4-enoate.
| Compound Name | methyl (E)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylpent-4-enoate |
|---|---|
| PubChem CID | 163914436 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | methyl (E)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylpent-4-enoate |
| SMILES | COC(=O)C(C)(C/C=C/c1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H25NO4/c1-17(2,3)23-16(21)19-18(4,15(20)22-5)13-9-12-14-10-7-6-8-11-14/h6-12H,13H2,1-5H3,(H,19,21)/b12-9+ |
| InChIKey | QUZTXPJRXSPWMP-FMIVXFBMSA-N |
| XLogP | 3.55 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |