About 1-(cyanomethyl)-1,3-diazinane-5-carbonitrile
1-(cyanomethyl)-1,3-diazinane-5-carbonitrile (PubChem CID 163917251) has the molecular formula C7H10N4
and a molecular weight of 150.19 g/mol. Its IUPAC name is 1-(cyanomethyl)-1,3-diazinane-5-carbonitrile.
Molecular Properties
| Compound Name | 1-(cyanomethyl)-1,3-diazinane-5-carbonitrile |
| PubChem CID | 163917251 |
| Molecular Formula | C7H10N4 |
| Molecular Weight | 150.19 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | 1-(cyanomethyl)-1,3-diazinane-5-carbonitrile |
| SMILES | N#CCN1CNCC(C#N)C1 |
| InChI | InChI=1S/C7H10N4/c8-1-2-11-5-7(3-9)4-10-6-11/h7,10H,2,4-6H2 |
| InChIKey | CXVSNYMGVVXKKK-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 62.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.19 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze 1-(cyanomethyl)-1,3-diazinane-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyanomethyl)-1,3-diazinane-5-carbonitrile?
The IUPAC name of 1-(cyanomethyl)-1,3-diazinane-5-carbonitrile (CID 163917251) is 1-(cyanomethyl)-1,3-diazinane-5-carbonitrile.
What is the SMILES notation for 1-(cyanomethyl)-1,3-diazinane-5-carbonitrile?
The canonical SMILES for 1-(cyanomethyl)-1,3-diazinane-5-carbonitrile is N#CCN1CNCC(C#N)C1.
What is the InChIKey of 1-(cyanomethyl)-1,3-diazinane-5-carbonitrile?
The InChIKey is CXVSNYMGVVXKKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4/c8-1-2-11-5-7(3-9)4-10-6-11/h7,10H,2,4-6H2.
What are the key properties of 1-(cyanomethyl)-1,3-diazinane-5-carbonitrile?
1-(cyanomethyl)-1,3-diazinane-5-carbonitrile has a molecular weight of 150.19 g/mol, XLogP of -0.49, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyanomethyl)-1,3-diazinane-5-carbonitrile is sourced from PubChem (CID 163917251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).