C7H10N4 — CID 163917251
1-(cyanomethyl)-1,3-diazinane-5-carbonitrile (PubChem CID 163917251) has the molecular formula C7H10N4 and a molecular weight of 150.19 g/mol. Its IUPAC name is 1-(cyanomethyl)-1,3-diazinane-5-carbonitrile.
| Compound Name | 1-(cyanomethyl)-1,3-diazinane-5-carbonitrile |
|---|---|
| PubChem CID | 163917251 |
| Molecular Formula | C7H10N4 |
| Molecular Weight | 150.19 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | 1-(cyanomethyl)-1,3-diazinane-5-carbonitrile |
| SMILES | N#CCN1CNCC(C#N)C1 |
| InChI | InChI=1S/C7H10N4/c8-1-2-11-5-7(3-9)4-10-6-11/h7,10H,2,4-6H2 |
| InChIKey | CXVSNYMGVVXKKK-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 62.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.19 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|