C15H25N3O3 — CID 163918410
(2S)-1-[(2S)-2-(3,3-dimethylbutanoylamino)but-3-enoyl]pyrrolidine-2-carboxamide (PubChem CID 163918410) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-(3,3-dimethylbutanoylamino)but-3-enoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2S)-2-(3,3-dimethylbutanoylamino)but-3-enoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 163918410 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | (2S)-1-[(2S)-2-(3,3-dimethylbutanoylamino)but-3-enoyl]pyrrolidine-2-carboxamide |
| SMILES | C=C[C@H](NC(=O)CC(C)(C)C)C(=O)N1CCC[C@H]1C(N)=O |
| InChI | InChI=1S/C15H25N3O3/c1-5-10(17-12(19)9-15(2,3)4)14(21)18-8-6-7-11(18)13(16)20/h5,10-11H,1,6-9H2,2-4H3,(H2,16,20)(H,17,19)/t10-,11-/m0/s1 |
| InChIKey | QYHNXYQTNWGMKD-QWRGUYRKSA-N |
| XLogP | 0.57 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|