C14H17N4O2- — CID 163920758
4-[1-(cyclopropylmethyl)pyrazol-4-yl]-2-N-methoxy-2-N-oxidobenzene-1,2-diamine (PubChem CID 163920758) has the molecular formula C14H17N4O2- and a molecular weight of 273.32 g/mol. Its IUPAC name is 4-[1-(cyclopropylmethyl)pyrazol-4-yl]-2-N-methoxy-2-N-oxidobenzene-1,2-diamine.
| Compound Name | 4-[1-(cyclopropylmethyl)pyrazol-4-yl]-2-N-methoxy-2-N-oxidobenzene-1,2-diamine |
|---|---|
| PubChem CID | 163920758 |
| Molecular Formula | C14H17N4O2- |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 4-[1-(cyclopropylmethyl)pyrazol-4-yl]-2-N-methoxy-2-N-oxidobenzene-1,2-diamine |
| SMILES | CON([O-])c1cc(-c2cnn(CC3CC3)c2)ccc1N |
| InChI | InChI=1S/C14H17N4O2/c1-20-18(19)14-6-11(4-5-13(14)15)12-7-16-17(9-12)8-10-2-3-10/h4-7,9-10H,2-3,8,15H2,1H3/q-1 |
| InChIKey | HSIRVXXEYNAWJT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|