C25H21BFN5O4- — CID 163920966
CID 163920966 (PubChem CID 163920966) has the molecular formula C25H21BFN5O4- and a molecular weight of 485.28 g/mol.
| Compound Name | CID 163920966 |
|---|---|
| PubChem CID | 163920966 |
| Molecular Formula | C25H21BFN5O4- |
| Molecular Weight | 485.28 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | — |
| SMILES | [B-]c1ccc(Nc2cc(=O)n(C)c3c2c(=O)n(C2CC2)c(=O)n3-c2cccc(NC(C)=O)c2)c(F)c1 |
| InChI | InChI=1S/C25H21BFN5O4/c1-13(33)28-15-4-3-5-17(11-15)31-23-22(24(35)32(25(31)36)16-7-8-16)20(12-21(34)30(23)2)29-19-9-6-14(26)10-18(19)27/h3-6,9-12,16,29H,7-8H2,1-2H3,(H,28,33)/q-1 |
| InChIKey | VODTUCPCDGLBPP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|