C22H18ClNO4 — CID 163923949
carbon dioxide;N-(3-chlorophenyl)-3-[3-(4-hydroxyphenyl)phenyl]propanamide (PubChem CID 163923949) has the molecular formula C22H18ClNO4 and a molecular weight of 395.84 g/mol. Its IUPAC name is carbon dioxide;N-(3-chlorophenyl)-3-[3-(4-hydroxyphenyl)phenyl]propanamide.
| Compound Name | carbon dioxide;N-(3-chlorophenyl)-3-[3-(4-hydroxyphenyl)phenyl]propanamide |
|---|---|
| PubChem CID | 163923949 |
| Molecular Formula | C22H18ClNO4 |
| Molecular Weight | 395.84 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | carbon dioxide;N-(3-chlorophenyl)-3-[3-(4-hydroxyphenyl)phenyl]propanamide |
| SMILES | O=C(CCc1cccc(-c2ccc(O)cc2)c1)Nc1cccc(Cl)c1.O=C=O |
| InChI | InChI=1S/C21H18ClNO2.CO2/c22-18-5-2-6-19(14-18)23-21(25)12-7-15-3-1-4-17(13-15)16-8-10-20(24)11-9-16;2-1-3/h1-6,8-11,13-14,24H,7,12H2,(H,23,25); |
| InChIKey | RCVGKJQVBDRWOS-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.84 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |