C17H28N2O3 — CID 163924054
tert-butyl N-[3-amino-3-(3,3-dicyclopropylpropoxy)prop-2-enylidene]carbamate (PubChem CID 163924054) has the molecular formula C17H28N2O3 and a molecular weight of 308.42 g/mol. Its IUPAC name is tert-butyl N-[3-amino-3-(3,3-dicyclopropylpropoxy)prop-2-enylidene]carbamate.
| Compound Name | tert-butyl N-[3-amino-3-(3,3-dicyclopropylpropoxy)prop-2-enylidene]carbamate |
|---|---|
| PubChem CID | 163924054 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | tert-butyl N-[3-amino-3-(3,3-dicyclopropylpropoxy)prop-2-enylidene]carbamate |
| SMILES | CC(C)(C)OC(=O)N=CC=C(N)OCCC(C1CC1)C1CC1 |
| InChI | InChI=1S/C17H28N2O3/c1-17(2,3)22-16(20)19-10-8-15(18)21-11-9-14(12-4-5-12)13-6-7-13/h8,10,12-14H,4-7,9,11,18H2,1-3H3 |
| InChIKey | OPDFKMJOELIVLA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|