C25H26N6O3 — CID 163925385
N-[[4-(6-amino-9-cyclopentyl-8-oxopurin-7-yl)phenyl]methyl]-2-methoxybenzamide (PubChem CID 163925385) has the molecular formula C25H26N6O3 and a molecular weight of 458.52 g/mol. Its IUPAC name is N-[[4-(6-amino-9-cyclopentyl-8-oxopurin-7-yl)phenyl]methyl]-2-methoxybenzamide.
| Compound Name | N-[[4-(6-amino-9-cyclopentyl-8-oxopurin-7-yl)phenyl]methyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 163925385 |
| Molecular Formula | C25H26N6O3 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | N-[[4-(6-amino-9-cyclopentyl-8-oxopurin-7-yl)phenyl]methyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)NCc1ccc(-n2c(=O)n(C3CCCC3)c3ncnc(N)c32)cc1 |
| InChI | InChI=1S/C25H26N6O3/c1-34-20-9-5-4-8-19(20)24(32)27-14-16-10-12-18(13-11-16)30-21-22(26)28-15-29-23(21)31(25(30)33)17-6-2-3-7-17/h4-5,8-13,15,17H,2-3,6-7,14H2,1H3,(H,27,32)(H2,26,28,29) |
| InChIKey | REAUXINBYJCNSN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 117.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |