C27H29FN7O5- — CID 163988985
N-[[4-[6-amino-9-[4-[methoxy(oxido)amino]cyclohexyl]-8-oxopurin-7-yl]phenyl]methyl]-5-fluoro-2-methoxybenzamide (PubChem CID 163988985) has the molecular formula C27H29FN7O5- and a molecular weight of 550.57 g/mol. Its IUPAC name is N-[[4-[6-amino-9-[4-[methoxy(oxido)amino]cyclohexyl]-8-oxopurin-7-yl]phenyl]methyl]-5-fluoro-2-methoxybenzamide.
| Compound Name | N-[[4-[6-amino-9-[4-[methoxy(oxido)amino]cyclohexyl]-8-oxopurin-7-yl]phenyl]methyl]-5-fluoro-2-methoxybenzamide |
|---|---|
| PubChem CID | 163988985 |
| Molecular Formula | C27H29FN7O5- |
| Molecular Weight | 550.57 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | N-[[4-[6-amino-9-[4-[methoxy(oxido)amino]cyclohexyl]-8-oxopurin-7-yl]phenyl]methyl]-5-fluoro-2-methoxybenzamide |
| SMILES | COc1ccc(F)cc1C(=O)NCc1ccc(-n2c(=O)n(C3CCC(N([O-])OC)CC3)c3ncnc(N)c32)cc1 |
| InChI | InChI=1S/C27H29FN7O5/c1-39-22-12-5-17(28)13-21(22)26(36)30-14-16-3-6-18(7-4-16)33-23-24(29)31-15-32-25(23)34(27(33)37)19-8-10-20(11-9-19)35(38)40-2/h3-7,12-13,15,19-20H,8-11,14H2,1-2H3,(H,30,36)(H2,29,31,32)/q-1 |
| InChIKey | JOHVFOXUJFKGHZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 152.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.57 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|