C30H16F6O6 — CID 163927806
[4-(3,5-difluoro-4-prop-2-enoyloxyphenyl)-2-fluorophenyl] (E)-3-[2,6-difluoro-4-(3-fluoro-4-hydroxyphenyl)phenoxy]prop-2-enoate (PubChem CID 163927806) has the molecular formula C30H16F6O6 and a molecular weight of 586.44 g/mol. Its IUPAC name is [4-(3,5-difluoro-4-prop-2-enoyloxyphenyl)-2-fluorophenyl] (E)-3-[2,6-difluoro-4-(3-fluoro-4-hydroxyphenyl)phenoxy]prop-2-enoate.
| Compound Name | [4-(3,5-difluoro-4-prop-2-enoyloxyphenyl)-2-fluorophenyl] (E)-3-[2,6-difluoro-4-(3-fluoro-4-hydroxyphenyl)phenoxy]prop-2-enoate |
|---|---|
| PubChem CID | 163927806 |
| Molecular Formula | C30H16F6O6 |
| Molecular Weight | 586.44 g/mol |
| Exact Mass | 586.09 |
| IUPAC Name | [4-(3,5-difluoro-4-prop-2-enoyloxyphenyl)-2-fluorophenyl] (E)-3-[2,6-difluoro-4-(3-fluoro-4-hydroxyphenyl)phenoxy]prop-2-enoate |
| SMILES | C=CC(=O)Oc1c(F)cc(-c2ccc(OC(=O)/C=C/Oc3c(F)cc(-c4ccc(O)c(F)c4)cc3F)c(F)c2)cc1F |
| InChI | InChI=1S/C30H16F6O6/c1-2-27(38)42-30-23(35)13-18(14-24(30)36)16-4-6-26(20(32)10-16)41-28(39)7-8-40-29-21(33)11-17(12-22(29)34)15-3-5-25(37)19(31)9-15/h2-14,37H,1H2/b8-7+ |
| InChIKey | RFZZTOSQNLVGPS-BQYQJAHWSA-N |
| XLogP | 7.15 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.44 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|