C23H36FN7O4S — CID 163928887
(2S)-1-[6-[2-[(2R)-4-cyclopentyl-2-[[formyl(hydroxy)amino]methyl]butanoyl]hydrazinyl]-5-fluoro-2-methylsulfanylpyrimidin-4-yl]-N,N-dimethylpyrrolidine-2-carboxamide (PubChem CID 163928887) has the molecular formula C23H36FN7O4S and a molecular weight of 525.65 g/mol. Its IUPAC name is (2S)-1-[6-[2-[(2R)-4-cyclopentyl-2-[[formyl(hydroxy)amino]methyl]butanoyl]hydrazinyl]-5-fluoro-2-methylsulfanylpyrimidin-4-yl]-N,N-dimethylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[6-[2-[(2R)-4-cyclopentyl-2-[[formyl(hydroxy)amino]methyl]butanoyl]hydrazinyl]-5-fluoro-2-methylsulfanylpyrimidin-4-yl]-N,N-dimethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 163928887 |
| Molecular Formula | C23H36FN7O4S |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | (2S)-1-[6-[2-[(2R)-4-cyclopentyl-2-[[formyl(hydroxy)amino]methyl]butanoyl]hydrazinyl]-5-fluoro-2-methylsulfanylpyrimidin-4-yl]-N,N-dimethylpyrrolidine-2-carboxamide |
| SMILES | CSc1nc(NNC(=O)[C@H](CCC2CCCC2)CN(O)C=O)c(F)c(N2CCC[C@H]2C(=O)N(C)C)n1 |
| InChI | InChI=1S/C23H36FN7O4S/c1-29(2)22(34)17-9-6-12-31(17)20-18(24)19(25-23(26-20)36-3)27-28-21(33)16(13-30(35)14-32)11-10-15-7-4-5-8-15/h14-17,35H,4-13H2,1-3H3,(H,28,33)(H,25,26,27)/t16-,17+/m1/s1 |
| InChIKey | RGYVTIBISULLBP-SJORKVTESA-N |
| XLogP | 2.27 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|