C22H35ClFN7O3 — CID 163513318
N-[(2R)-2-[[[2-chloro-5-fluoro-6-[(2S,3R)-2,3,4-trimethylpiperazin-1-yl]pyrimidin-4-yl]amino]carbamoyl]-4-cyclopentylbutyl]-N-hydroxyformamide (PubChem CID 163513318) has the molecular formula C22H35ClFN7O3 and a molecular weight of 500.02 g/mol. Its IUPAC name is N-[(2R)-2-[[[2-chloro-5-fluoro-6-[(2S,3R)-2,3,4-trimethylpiperazin-1-yl]pyrimidin-4-yl]amino]carbamoyl]-4-cyclopentylbutyl]-N-hydroxyformamide.
| Compound Name | N-[(2R)-2-[[[2-chloro-5-fluoro-6-[(2S,3R)-2,3,4-trimethylpiperazin-1-yl]pyrimidin-4-yl]amino]carbamoyl]-4-cyclopentylbutyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 163513318 |
| Molecular Formula | C22H35ClFN7O3 |
| Molecular Weight | 500.02 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | N-[(2R)-2-[[[2-chloro-5-fluoro-6-[(2S,3R)-2,3,4-trimethylpiperazin-1-yl]pyrimidin-4-yl]amino]carbamoyl]-4-cyclopentylbutyl]-N-hydroxyformamide |
| SMILES | C[C@@H]1[C@H](C)N(c2nc(Cl)nc(NNC(=O)[C@H](CCC3CCCC3)CN(O)C=O)c2F)CCN1C |
| InChI | InChI=1S/C22H35ClFN7O3/c1-14-15(2)31(11-10-29(14)3)20-18(24)19(25-22(23)26-20)27-28-21(33)17(12-30(34)13-32)9-8-16-6-4-5-7-16/h13-17,34H,4-12H2,1-3H3,(H,28,33)(H,25,26,27)/t14-,15+,17-/m1/s1 |
| InChIKey | DEOLPYLEGFEEEP-HLLBOEOZSA-N |
| XLogP | 2.68 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.02 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|