C33H31N3O — CID 163931065
9-methoxy-3,4-bis(2,4,6-trimethylphenyl)-2,5,17-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7(12),8,10,14,16-octaene (PubChem CID 163931065) has the molecular formula C33H31N3O and a molecular weight of 485.63 g/mol. Its IUPAC name is 9-methoxy-3,4-bis(2,4,6-trimethylphenyl)-2,5,17-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7(12),8,10,14,16-octaene.
| Compound Name | 9-methoxy-3,4-bis(2,4,6-trimethylphenyl)-2,5,17-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7(12),8,10,14,16-octaene |
|---|---|
| PubChem CID | 163931065 |
| Molecular Formula | C33H31N3O |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | 9-methoxy-3,4-bis(2,4,6-trimethylphenyl)-2,5,17-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7(12),8,10,14,16-octaene |
| SMILES | COc1ccc2c3cccnc3n3c(-c4c(C)cc(C)cc4C)c(-c4c(C)cc(C)cc4C)nc3c2c1 |
| InChI | InChI=1S/C33H31N3O/c1-18-13-20(3)28(21(4)14-18)30-31(29-22(5)15-19(2)16-23(29)6)36-32-26(9-8-12-34-32)25-11-10-24(37-7)17-27(25)33(36)35-30/h8-17H,1-7H3 |
| InChIKey | ZGZSFFYJNFLWSW-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|