C38H29N5O — CID 176784098
9-[3-(3-phenylpyrazol-1-yl)phenoxy]-3-(2,4,6-trimethylphenyl)-2,5,17-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7(12),8,10,14,16-octaene (PubChem CID 176784098) has the molecular formula C38H29N5O and a molecular weight of 571.68 g/mol. Its IUPAC name is 9-[3-(3-phenylpyrazol-1-yl)phenoxy]-3-(2,4,6-trimethylphenyl)-2,5,17-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7(12),8,10,14,16-octaene.
| Compound Name | 9-[3-(3-phenylpyrazol-1-yl)phenoxy]-3-(2,4,6-trimethylphenyl)-2,5,17-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7(12),8,10,14,16-octaene |
|---|---|
| PubChem CID | 176784098 |
| Molecular Formula | C38H29N5O |
| Molecular Weight | 571.68 g/mol |
| Exact Mass | 571.24 |
| IUPAC Name | 9-[3-(3-phenylpyrazol-1-yl)phenoxy]-3-(2,4,6-trimethylphenyl)-2,5,17-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7(12),8,10,14,16-octaene |
| SMILES | Cc1cc(C)c(-c2cnc3c4cc(Oc5cccc(-n6ccc(-c7ccccc7)n6)c5)ccc4c4cccnc4n23)c(C)c1 |
| InChI | InChI=1S/C38H29N5O/c1-24-19-25(2)36(26(3)20-24)35-23-40-38-33-22-30(14-15-31(33)32-13-8-17-39-37(32)43(35)38)44-29-12-7-11-28(21-29)42-18-16-34(41-42)27-9-5-4-6-10-27/h4-23H,1-3H3 |
| InChIKey | BFPQEAOVHZSNBR-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 57.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.68 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|