C21H28IN3O4 — CID 163932989
2-hydroxy-3-[iodo-[2-(6-methylheptan-2-ylamino)-3,4-dioxocyclobuten-1-yl]amino]-N,N-dimethylbenzamide (PubChem CID 163932989) has the molecular formula C21H28IN3O4 and a molecular weight of 513.38 g/mol. Its IUPAC name is 2-hydroxy-3-[iodo-[2-(6-methylheptan-2-ylamino)-3,4-dioxocyclobuten-1-yl]amino]-N,N-dimethylbenzamide.
| Compound Name | 2-hydroxy-3-[iodo-[2-(6-methylheptan-2-ylamino)-3,4-dioxocyclobuten-1-yl]amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 163932989 |
| Molecular Formula | C21H28IN3O4 |
| Molecular Weight | 513.38 g/mol |
| Exact Mass | 513.11 |
| IUPAC Name | 2-hydroxy-3-[iodo-[2-(6-methylheptan-2-ylamino)-3,4-dioxocyclobuten-1-yl]amino]-N,N-dimethylbenzamide |
| SMILES | CC(C)CCCC(C)Nc1c(N(I)c2cccc(C(=O)N(C)C)c2O)c(=O)c1=O |
| InChI | InChI=1S/C21H28IN3O4/c1-12(2)8-6-9-13(3)23-16-17(20(28)19(16)27)25(22)15-11-7-10-14(18(15)26)21(29)24(4)5/h7,10-13,23,26H,6,8-9H2,1-5H3 |
| InChIKey | RKHFEMMVVAIRII-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|