C21H28LiN3O4 — CID 142180128
lithium [3-(dimethylcarbamoyl)-2-hydroxyphenyl]-[2-[[(2S)-octan-2-yl]amino]-3,4-dioxocyclobuten-1-yl]azanide (PubChem CID 142180128) has the molecular formula C21H28LiN3O4 and a molecular weight of 393.41 g/mol. Its IUPAC name is lithium [3-(dimethylcarbamoyl)-2-hydroxyphenyl]-[2-[[(2S)-octan-2-yl]amino]-3,4-dioxocyclobuten-1-yl]azanide.
| Compound Name | lithium [3-(dimethylcarbamoyl)-2-hydroxyphenyl]-[2-[[(2S)-octan-2-yl]amino]-3,4-dioxocyclobuten-1-yl]azanide |
|---|---|
| PubChem CID | 142180128 |
| Molecular Formula | C21H28LiN3O4 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | lithium [3-(dimethylcarbamoyl)-2-hydroxyphenyl]-[2-[[(2S)-octan-2-yl]amino]-3,4-dioxocyclobuten-1-yl]azanide |
| SMILES | CCCCCC[C@H](C)Nc1c([N-]c2cccc(C(=O)N(C)C)c2O)c(=O)c1=O.[Li+] |
| InChI | InChI=1S/C21H29N3O4.Li/c1-5-6-7-8-10-13(2)22-16-17(20(27)19(16)26)23-15-12-9-11-14(18(15)25)21(28)24(3)4;/h9,11-13H,5-8,10H2,1-4H3,(H3,22,23,25,26,27,28);/q;+1/p-1/t13-;/m0./s1 |
| InChIKey | LKCGGSIFDWROTN-ZOWNYOTGSA-M |
| XLogP | 0.80 |
| TPSA | 100.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|