C7H9NO2 — CID 163933050
2-amino-5-ethenyl-2,3-dihydropyran-6-one (PubChem CID 163933050) has the molecular formula C7H9NO2 and a molecular weight of 139.15 g/mol. Its IUPAC name is 2-amino-5-ethenyl-2,3-dihydropyran-6-one.
| Compound Name | 2-amino-5-ethenyl-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 163933050 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | 2-amino-5-ethenyl-2,3-dihydropyran-6-one |
| SMILES | C=CC1=CCC(N)OC1=O |
| InChI | InChI=1S/C7H9NO2/c1-2-5-3-4-6(8)10-7(5)9/h2-3,6H,1,4,8H2 |
| InChIKey | RKIQFLAMJHBDJG-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |