C27H24Cl4N2O3 — CID 163936899
2-methylindolizine;2,3,4,5-tetrachloro-6-[4-(diethylamino)benzoyl]benzoic acid (PubChem CID 163936899) has the molecular formula C27H24Cl4N2O3 and a molecular weight of 566.31 g/mol. Its IUPAC name is 2-methylindolizine;2,3,4,5-tetrachloro-6-[4-(diethylamino)benzoyl]benzoic acid.
| Compound Name | 2-methylindolizine;2,3,4,5-tetrachloro-6-[4-(diethylamino)benzoyl]benzoic acid |
|---|---|
| PubChem CID | 163936899 |
| Molecular Formula | C27H24Cl4N2O3 |
| Molecular Weight | 566.31 g/mol |
| Exact Mass | 564.05 |
| IUPAC Name | 2-methylindolizine;2,3,4,5-tetrachloro-6-[4-(diethylamino)benzoyl]benzoic acid |
| SMILES | CCN(CC)c1ccc(C(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C(=O)O)cc1.Cc1cc2ccccn2c1 |
| InChI | InChI=1S/C18H15Cl4NO3.C9H9N/c1-3-23(4-2)10-7-5-9(6-8-10)17(24)11-12(18(25)26)14(20)16(22)15(21)13(11)19;1-8-6-9-4-2-3-5-10(9)7-8/h5-8H,3-4H2,1-2H3,(H,25,26);2-7H,1H3 |
| InChIKey | RNPGSYHMYFKTRF-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 62.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.31 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|