About [2-(diethylamino)phenyl]-phenylmethanone;2-phenylindolizine
[2-(diethylamino)phenyl]-phenylmethanone;2-phenylindolizine (PubChem CID 20536957) has the molecular formula C31H30N2O
and a molecular weight of 446.59 g/mol. Its IUPAC name is [2-(diethylamino)phenyl]-phenylmethanone;2-phenylindolizine.
Molecular Properties
| Compound Name | [2-(diethylamino)phenyl]-phenylmethanone;2-phenylindolizine |
| PubChem CID | 20536957 |
| Molecular Formula | C31H30N2O |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | [2-(diethylamino)phenyl]-phenylmethanone;2-phenylindolizine |
| SMILES | CCN(CC)c1ccccc1C(=O)c1ccccc1.c1ccc(-c2cc3ccccn3c2)cc1 |
| InChI | InChI=1S/C17H19NO.C14H11N/c1-3-18(4-2)16-13-9-8-12-15(16)17(19)14-10-6-5-7-11-14;1-2-6-12(7-3-1)13-10-14-8-4-5-9-15(14)11-13/h5-13H,3-4H2,1-2H3;1-11H |
| InChIKey | CHDOALZPBVAYFU-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(diethylamino)phenyl]-phenylmethanone;2-phenylindolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(diethylamino)phenyl]-phenylmethanone;2-phenylindolizine?
The IUPAC name of [2-(diethylamino)phenyl]-phenylmethanone;2-phenylindolizine (CID 20536957) is [2-(diethylamino)phenyl]-phenylmethanone;2-phenylindolizine.
What is the SMILES notation for [2-(diethylamino)phenyl]-phenylmethanone;2-phenylindolizine?
The canonical SMILES for [2-(diethylamino)phenyl]-phenylmethanone;2-phenylindolizine is CCN(CC)c1ccccc1C(=O)c1ccccc1.c1ccc(-c2cc3ccccn3c2)cc1.
What is the InChIKey of [2-(diethylamino)phenyl]-phenylmethanone;2-phenylindolizine?
The InChIKey is CHDOALZPBVAYFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO.C14H11N/c1-3-18(4-2)16-13-9-8-12-15(16)17(19)14-10-6-5-7-11-14;1-2-6-12(7-3-1)13-10-14-8-4-5-9-15(14)11-13/h5-13H,3-4H2,1-2H3;1-11H.
What are the key properties of [2-(diethylamino)phenyl]-phenylmethanone;2-phenylindolizine?
[2-(diethylamino)phenyl]-phenylmethanone;2-phenylindolizine has a molecular weight of 446.59 g/mol, XLogP of 7.37, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(diethylamino)phenyl]-phenylmethanone;2-phenylindolizine is sourced from PubChem (CID 20536957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).