C32H25N3O5 — CID 163740121
2-(1,2-dimethylindole-3-carbonyl)-6-nitrobenzoic acid;2-phenylindolizine (PubChem CID 163740121) has the molecular formula C32H25N3O5 and a molecular weight of 531.57 g/mol. Its IUPAC name is 2-(1,2-dimethylindole-3-carbonyl)-6-nitrobenzoic acid;2-phenylindolizine.
| Compound Name | 2-(1,2-dimethylindole-3-carbonyl)-6-nitrobenzoic acid;2-phenylindolizine |
|---|---|
| PubChem CID | 163740121 |
| Molecular Formula | C32H25N3O5 |
| Molecular Weight | 531.57 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | 2-(1,2-dimethylindole-3-carbonyl)-6-nitrobenzoic acid;2-phenylindolizine |
| SMILES | Cc1c(C(=O)c2cccc([N+](=O)[O-])c2C(=O)O)c2ccccc2n1C.c1ccc(-c2cc3ccccn3c2)cc1 |
| InChI | InChI=1S/C18H14N2O5.C14H11N/c1-10-15(11-6-3-4-8-13(11)19(10)2)17(21)12-7-5-9-14(20(24)25)16(12)18(22)23;1-2-6-12(7-3-1)13-10-14-8-4-5-9-15(14)11-13/h3-9H,1-2H3,(H,22,23);1-11H |
| InChIKey | LHAIAYITOKWVPI-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 106.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.57 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|