C20H18N2O — CID 23544603
(1,2-dimethylindol-3-yl)-(1-methylindol-3-yl)methanone (PubChem CID 23544603) has the molecular formula C20H18N2O and a molecular weight of 302.38 g/mol. Its IUPAC name is (1,2-dimethylindol-3-yl)-(1-methylindol-3-yl)methanone.
| Compound Name | (1,2-dimethylindol-3-yl)-(1-methylindol-3-yl)methanone |
|---|---|
| PubChem CID | 23544603 |
| Molecular Formula | C20H18N2O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | (1,2-dimethylindol-3-yl)-(1-methylindol-3-yl)methanone |
| SMILES | Cc1c(C(=O)c2cn(C)c3ccccc23)c2ccccc2n1C |
| InChI | InChI=1S/C20H18N2O/c1-13-19(15-9-5-7-11-18(15)22(13)3)20(23)16-12-21(2)17-10-6-4-8-14(16)17/h4-12H,1-3H3 |
| InChIKey | UJSLOSLGVVTSRI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |