C11H14N4 — CID 83532039
N'-amino-1,2-dimethylindole-3-carboximidamide (PubChem CID 83532039) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is N'-amino-1,2-dimethylindole-3-carboximidamide.
| Compound Name | N'-amino-1,2-dimethylindole-3-carboximidamide |
|---|---|
| PubChem CID | 83532039 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | N'-amino-1,2-dimethylindole-3-carboximidamide |
| SMILES | Cc1c(/C(N)=N/N)c2ccccc2n1C |
| InChI | InChI=1S/C11H14N4/c1-7-10(11(12)14-13)8-5-3-4-6-9(8)15(7)2/h3-6H,13H2,1-2H3,(H2,12,14) |
| InChIKey | IYGMAXQOKVQTRY-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 69.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|