C14H16N2 — CID 163942685
(1E)-1-(1,2-dimethylindol-3-yl)buta-1,3-dien-2-amine (PubChem CID 163942685) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is (1E)-1-(1,2-dimethylindol-3-yl)buta-1,3-dien-2-amine.
| Compound Name | (1E)-1-(1,2-dimethylindol-3-yl)buta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 163942685 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | (1E)-1-(1,2-dimethylindol-3-yl)buta-1,3-dien-2-amine |
| SMILES | C=C/C(N)=C\c1c(C)n(C)c2ccccc12 |
| InChI | InChI=1S/C14H16N2/c1-4-11(15)9-13-10(2)16(3)14-8-6-5-7-12(13)14/h4-9H,1,15H2,2-3H3/b11-9+ |
| InChIKey | RSJJUWFTFMFCTF-PKNBQFBNSA-N |
| XLogP | 2.97 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|