About 2-(1-methyl-2-phenylindole-3-carbonyl)-6-nitrobenzoic acid;1-methyl-2-phenylindolizine
2-(1-methyl-2-phenylindole-3-carbonyl)-6-nitrobenzoic acid;1-methyl-2-phenylindolizine (PubChem CID 163932663) has the molecular formula C38H29N3O5
and a molecular weight of 607.67 g/mol. Its IUPAC name is 2-(1-methyl-2-phenylindole-3-carbonyl)-6-nitrobenzoic acid;1-methyl-2-phenylindolizine.
Molecular Properties
| Compound Name | 2-(1-methyl-2-phenylindole-3-carbonyl)-6-nitrobenzoic acid;1-methyl-2-phenylindolizine |
| PubChem CID | 163932663 |
| Molecular Formula | C38H29N3O5 |
| Molecular Weight | 607.67 g/mol |
| Exact Mass | 607.21 |
| IUPAC Name | 2-(1-methyl-2-phenylindole-3-carbonyl)-6-nitrobenzoic acid;1-methyl-2-phenylindolizine |
| SMILES | Cc1c(-c2ccccc2)cn2ccccc12.Cn1c(-c2ccccc2)c(C(=O)c2cccc([N+](=O)[O-])c2C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C23H16N2O5.C15H13N/c1-24-17-12-6-5-10-15(17)20(21(24)14-8-3-2-4-9-14)22(26)16-11-7-13-18(25(29)30)19(16)23(27)28;1-12-14(13-7-3-2-4-8-13)11-16-10-6-5-9-15(12)16/h2-13H,1H3,(H,27,28);2-11H,1H3 |
| InChIKey | RKAIHKOMHQDDMK-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 106.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 607.67 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-methyl-2-phenylindole-3-carbonyl)-6-nitrobenzoic acid;1-methyl-2-phenylindolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methyl-2-phenylindole-3-carbonyl)-6-nitrobenzoic acid;1-methyl-2-phenylindolizine?
The IUPAC name of 2-(1-methyl-2-phenylindole-3-carbonyl)-6-nitrobenzoic acid;1-methyl-2-phenylindolizine (CID 163932663) is 2-(1-methyl-2-phenylindole-3-carbonyl)-6-nitrobenzoic acid;1-methyl-2-phenylindolizine.
What is the SMILES notation for 2-(1-methyl-2-phenylindole-3-carbonyl)-6-nitrobenzoic acid;1-methyl-2-phenylindolizine?
The canonical SMILES for 2-(1-methyl-2-phenylindole-3-carbonyl)-6-nitrobenzoic acid;1-methyl-2-phenylindolizine is Cc1c(-c2ccccc2)cn2ccccc12.Cn1c(-c2ccccc2)c(C(=O)c2cccc([N+](=O)[O-])c2C(=O)O)c2ccccc21.
What is the InChIKey of 2-(1-methyl-2-phenylindole-3-carbonyl)-6-nitrobenzoic acid;1-methyl-2-phenylindolizine?
The InChIKey is RKAIHKOMHQDDMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16N2O5.C15H13N/c1-24-17-12-6-5-10-15(17)20(21(24)14-8-3-2-4-9-14)22(26)16-11-7-13-18(25(29)30)19(16)23(27)28;1-12-14(13-7-3-2-4-8-13)11-16-10-6-5-9-15(12)16/h2-13H,1H3,(H,27,28);2-11H,1H3.
What are the key properties of 2-(1-methyl-2-phenylindole-3-carbonyl)-6-nitrobenzoic acid;1-methyl-2-phenylindolizine?
2-(1-methyl-2-phenylindole-3-carbonyl)-6-nitrobenzoic acid;1-methyl-2-phenylindolizine has a molecular weight of 607.67 g/mol, XLogP of 8.60, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methyl-2-phenylindole-3-carbonyl)-6-nitrobenzoic acid;1-methyl-2-phenylindolizine is sourced from PubChem (CID 163932663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).