C10H24N5O2+3 — CID 163937718
[2-[4-(2-hydrazinyl-2-oxoethyl)-1,4-dimethylpiperazine-1,4-diium-1-yl]acetyl]azanium (PubChem CID 163937718) has the molecular formula C10H24N5O2+3 and a molecular weight of 246.33 g/mol. Its IUPAC name is [2-[4-(2-hydrazinyl-2-oxoethyl)-1,4-dimethylpiperazine-1,4-diium-1-yl]acetyl]azanium.
| Compound Name | [2-[4-(2-hydrazinyl-2-oxoethyl)-1,4-dimethylpiperazine-1,4-diium-1-yl]acetyl]azanium |
|---|---|
| PubChem CID | 163937718 |
| Molecular Formula | C10H24N5O2+3 |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | [2-[4-(2-hydrazinyl-2-oxoethyl)-1,4-dimethylpiperazine-1,4-diium-1-yl]acetyl]azanium |
| SMILES | C[N+]1(CC([NH3+])=O)CC[N+](C)(CC(=O)NN)CC1 |
| InChI | InChI=1S/C10H21N5O2/c1-14(7-9(11)16)3-5-15(2,6-4-14)8-10(17)13-12/h3-8,12H2,1-2H3,(H-2,11,13,16,17)/p+3 |
| InChIKey | ROFRERWGLIMUCO-UHFFFAOYSA-Q |
| XLogP | -3.35 |
| TPSA | 99.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | -3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|