C20H18BrFN2O3 — CID 163937820
6-bromo-N-(3-fluorophenyl)-4-hydroxy-1-(2-methylpropyl)-2-oxoquinoline-3-carboxamide (PubChem CID 163937820) has the molecular formula C20H18BrFN2O3 and a molecular weight of 433.28 g/mol. Its IUPAC name is 6-bromo-N-(3-fluorophenyl)-4-hydroxy-1-(2-methylpropyl)-2-oxoquinoline-3-carboxamide.
| Compound Name | 6-bromo-N-(3-fluorophenyl)-4-hydroxy-1-(2-methylpropyl)-2-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 163937820 |
| Molecular Formula | C20H18BrFN2O3 |
| Molecular Weight | 433.28 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | 6-bromo-N-(3-fluorophenyl)-4-hydroxy-1-(2-methylpropyl)-2-oxoquinoline-3-carboxamide |
| SMILES | CC(C)Cn1c(=O)c(C(=O)Nc2cccc(F)c2)c(O)c2cc(Br)ccc21 |
| InChI | InChI=1S/C20H18BrFN2O3/c1-11(2)10-24-16-7-6-12(21)8-15(16)18(25)17(20(24)27)19(26)23-14-5-3-4-13(22)9-14/h3-9,11,25H,10H2,1-2H3,(H,23,26) |
| InChIKey | ROHXHAQXEDCZSG-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.28 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |