C20H26N7+ — CID 163940869
[2-amino-4-cyclohexa-1,5-dien-1-yl-10-methyl-9-(methylideneamino)-1,3-diazaspiro[5.6]dodeca-2,7,9,11-tetraen-5-yl]-[(aminomethylideneamino)methylidene]azanium (PubChem CID 163940869) has the molecular formula C20H26N7+ and a molecular weight of 364.48 g/mol. Its IUPAC name is [2-amino-4-cyclohexa-1,5-dien-1-yl-10-methyl-9-(methylideneamino)-1,3-diazaspiro[5.6]dodeca-2,7,9,11-tetraen-5-yl]-[(aminomethylideneamino)methylidene]azanium.
| Compound Name | [2-amino-4-cyclohexa-1,5-dien-1-yl-10-methyl-9-(methylideneamino)-1,3-diazaspiro[5.6]dodeca-2,7,9,11-tetraen-5-yl]-[(aminomethylideneamino)methylidene]azanium |
|---|---|
| PubChem CID | 163940869 |
| Molecular Formula | C20H26N7+ |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | [2-amino-4-cyclohexa-1,5-dien-1-yl-10-methyl-9-(methylideneamino)-1,3-diazaspiro[5.6]dodeca-2,7,9,11-tetraen-5-yl]-[(aminomethylideneamino)methylidene]azanium |
| SMILES | C=NC1=C(C)C=CC2(C=C1)NC(N)=NC(C1=CCCC=C1)C2/[NH+]=C/N=C/N |
| InChI | InChI=1S/C20H25N7/c1-14-8-10-20(11-9-16(14)23-2)18(25-13-24-12-21)17(26-19(22)27-20)15-6-4-3-5-7-15/h4,6-13,17-18H,2-3,5H2,1H3,(H2,21,24,25)(H3,22,26,27)/p+1 |
| InChIKey | RQVXXVFSBPJYQN-UHFFFAOYSA-O |
| XLogP | -0.15 |
| TPSA | 115.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|