C20H25N7 — CID 163940870
N'-[2-amino-4-cyclohexa-1,5-dien-1-yl-10-methyl-9-(methylideneamino)-1,3-diazaspiro[5.6]dodeca-2,7,9,11-tetraen-5-yl]-N-(aminomethylidene)methanimidamide (PubChem CID 163940870) has the molecular formula C20H25N7 and a molecular weight of 363.47 g/mol. Its IUPAC name is N'-[2-amino-4-cyclohexa-1,5-dien-1-yl-10-methyl-9-(methylideneamino)-1,3-diazaspiro[5.6]dodeca-2,7,9,11-tetraen-5-yl]-N-(aminomethylidene)methanimidamide.
| Compound Name | N'-[2-amino-4-cyclohexa-1,5-dien-1-yl-10-methyl-9-(methylideneamino)-1,3-diazaspiro[5.6]dodeca-2,7,9,11-tetraen-5-yl]-N-(aminomethylidene)methanimidamide |
|---|---|
| PubChem CID | 163940870 |
| Molecular Formula | C20H25N7 |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | N'-[2-amino-4-cyclohexa-1,5-dien-1-yl-10-methyl-9-(methylideneamino)-1,3-diazaspiro[5.6]dodeca-2,7,9,11-tetraen-5-yl]-N-(aminomethylidene)methanimidamide |
| SMILES | C=NC1=C(C)C=CC2(C=C1)NC(N)=NC(C1=CCCC=C1)C2/N=C/N=C/N |
| InChI | InChI=1S/C20H25N7/c1-14-8-10-20(11-9-16(14)23-2)18(25-13-24-12-21)17(26-19(22)27-20)15-6-4-3-5-7-15/h4,6-13,17-18H,2-3,5H2,1H3,(H2,21,24,25)(H3,22,26,27) |
| InChIKey | RQVXXVFSBPJYQN-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|