C23H40O6 — CID 163940958
[5,7-bis(1-ethoxyethoxy)-7-methyl-1-tricyclo[3.3.1.03,9]nonanyl] 2,2-dimethylpropanoate (PubChem CID 163940958) has the molecular formula C23H40O6 and a molecular weight of 412.57 g/mol. Its IUPAC name is [5,7-bis(1-ethoxyethoxy)-7-methyl-1-tricyclo[3.3.1.03,9]nonanyl] 2,2-dimethylpropanoate.
| Compound Name | [5,7-bis(1-ethoxyethoxy)-7-methyl-1-tricyclo[3.3.1.03,9]nonanyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 163940958 |
| Molecular Formula | C23H40O6 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | [5,7-bis(1-ethoxyethoxy)-7-methyl-1-tricyclo[3.3.1.03,9]nonanyl] 2,2-dimethylpropanoate |
| SMILES | CCOC(C)OC1(C)CC2(OC(=O)C(C)(C)C)CC3CC(OC(C)OCC)(C1)C32 |
| InChI | InChI=1S/C23H40O6/c1-9-25-15(3)27-21(8)13-22(28-16(4)26-10-2)11-17-12-23(14-21,18(17)22)29-19(24)20(5,6)7/h15-18H,9-14H2,1-8H3 |
| InChIKey | RQXLPATVEDOKPW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|