C13H26N2 — CID 163944905
5-[(Z)-prop-1-enyl]imino-N-propylheptan-1-amine (PubChem CID 163944905) has the molecular formula C13H26N2 and a molecular weight of 210.37 g/mol. Its IUPAC name is 5-[(Z)-prop-1-enyl]imino-N-propylheptan-1-amine.
| Compound Name | 5-[(Z)-prop-1-enyl]imino-N-propylheptan-1-amine |
|---|---|
| PubChem CID | 163944905 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.37 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 5-[(Z)-prop-1-enyl]imino-N-propylheptan-1-amine |
| SMILES | C/C=C\N=C(/CC)CCCCNCCC |
| InChI | InChI=1S/C13H26N2/c1-4-10-14-12-8-7-9-13(6-3)15-11-5-2/h5,11,14H,4,6-10,12H2,1-3H3/b11-5-,15-13+ |
| InChIKey | RUGCORXXHICTLN-JSYAVDNYSA-N |
| XLogP | 3.54 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.37 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|