C35H56N2O — CID 163945129
1,15-bis[4-(diethylamino)phenyl]pentadecan-8-one (PubChem CID 163945129) has the molecular formula C35H56N2O and a molecular weight of 520.85 g/mol. Its IUPAC name is 1,15-bis[4-(diethylamino)phenyl]pentadecan-8-one.
| Compound Name | 1,15-bis[4-(diethylamino)phenyl]pentadecan-8-one |
|---|---|
| PubChem CID | 163945129 |
| Molecular Formula | C35H56N2O |
| Molecular Weight | 520.85 g/mol |
| Exact Mass | 520.44 |
| IUPAC Name | 1,15-bis[4-(diethylamino)phenyl]pentadecan-8-one |
| SMILES | CCN(CC)c1ccc(CCCCCCCC(=O)CCCCCCCc2ccc(N(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C35H56N2O/c1-5-36(6-2)33-27-23-31(24-28-33)19-15-11-9-13-17-21-35(38)22-18-14-10-12-16-20-32-25-29-34(30-26-32)37(7-3)8-4/h23-30H,5-22H2,1-4H3 |
| InChIKey | RUKKKTPWWDGTFN-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.85 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|