C31H27N3O7 — CID 163945282
5-[1'-(1-cyclopropyl-4-hydroperoxyindole-6-carbonyl)-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl]pyridine-3-carboxylic acid (PubChem CID 163945282) has the molecular formula C31H27N3O7 and a molecular weight of 553.57 g/mol. Its IUPAC name is 5-[1'-(1-cyclopropyl-4-hydroperoxyindole-6-carbonyl)-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl]pyridine-3-carboxylic acid.
| Compound Name | 5-[1'-(1-cyclopropyl-4-hydroperoxyindole-6-carbonyl)-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 163945282 |
| Molecular Formula | C31H27N3O7 |
| Molecular Weight | 553.57 g/mol |
| Exact Mass | 553.18 |
| IUPAC Name | 5-[1'-(1-cyclopropyl-4-hydroperoxyindole-6-carbonyl)-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cncc(-c2ccc3c(c2)C(=O)CC2(CCN(C(=O)c4cc(OO)c5ccn(C6CC6)c5c4)CC2)O3)c1 |
| InChI | InChI=1S/C31H27N3O7/c35-26-15-31(40-27-4-1-18(12-24(26)27)20-11-21(30(37)38)17-32-16-20)6-9-33(10-7-31)29(36)19-13-25-23(28(14-19)41-39)5-8-34(25)22-2-3-22/h1,4-5,8,11-14,16-17,22,39H,2-3,6-7,9-10,15H2,(H,37,38) |
| InChIKey | RUNWTNSCWWMXLB-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.57 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|