C33H31N3NaO6 — CID 66649446
CID 66649446 (PubChem CID 66649446) has the molecular formula C33H31N3NaO6 and a molecular weight of 588.62 g/mol.
| Compound Name | CID 66649446 |
|---|---|
| PubChem CID | 66649446 |
| Molecular Formula | C33H31N3NaO6 |
| Molecular Weight | 588.62 g/mol |
| Exact Mass | 588.21 |
| IUPAC Name | — |
| SMILES | CCOc1cc(C(=O)N2CCC3(CC2)CC(=O)c2cc(-c4cncc(C(=O)O)c4)ccc2O3)cc2c1ccn2C1CC1.[Na] |
| InChI | InChI=1S/C33H31N3O6.Na/c1-2-41-30-16-21(15-27-25(30)7-10-36(27)24-4-5-24)31(38)35-11-8-33(9-12-35)17-28(37)26-14-20(3-6-29(26)42-33)22-13-23(32(39)40)19-34-18-22;/h3,6-7,10,13-16,18-19,24H,2,4-5,8-9,11-12,17H2,1H3,(H,39,40); |
| InChIKey | STGSUWCBCLKULO-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.62 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |