C47H28N4U — CID 163946403
12-[3-[4-phenyl-6-(3-phenylbenzene-4-id-1-yl)-1,3,5-triazin-2-yl]phenyl]-12-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene;uranium(2+) (PubChem CID 163946403) has the molecular formula C47H28N4U and a molecular weight of 886.80 g/mol. Its IUPAC name is 12-[3-[4-phenyl-6-(3-phenylbenzene-4-id-1-yl)-1,3,5-triazin-2-yl]phenyl]-12-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene;uranium(2+).
| Compound Name | 12-[3-[4-phenyl-6-(3-phenylbenzene-4-id-1-yl)-1,3,5-triazin-2-yl]phenyl]-12-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene;uranium(2+) |
|---|---|
| PubChem CID | 163946403 |
| Molecular Formula | C47H28N4U |
| Molecular Weight | 886.80 g/mol |
| Exact Mass | 886.28 |
| IUPAC Name | 12-[3-[4-phenyl-6-(3-phenylbenzene-4-id-1-yl)-1,3,5-triazin-2-yl]phenyl]-12-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene;uranium(2+) |
| SMILES | [U+2].[c-]1ccccc1-c1[c-]ccc(-c2nc(-c3ccccc3)nc(-c3cccc(N4c5cc6ccccc6cc5-c5cccc6cccc4c56)c3)n2)c1 |
| InChI | InChI=1S/C47H28N4.U/c1-3-13-31(14-4-1)34-21-9-22-37(27-34)46-48-45(33-15-5-2-6-16-33)49-47(50-46)38-23-10-24-39(28-38)51-42-26-12-20-32-19-11-25-40(44(32)42)41-29-35-17-7-8-18-36(35)30-43(41)51;/h1-13,15-20,22-30H;/q-2;+2 |
| InChIKey | QJSNQCYJASNXTR-UHFFFAOYSA-N |
| XLogP | 11.90 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 886.80 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|