About N,N-diethylethanamine;N,N-dimethylmethanamine;pyridine
N,N-diethylethanamine;N,N-dimethylmethanamine;pyridine (PubChem CID 163946684) has the molecular formula C14H29N3
and a molecular weight of 239.41 g/mol. Its IUPAC name is N,N-diethylethanamine;N,N-dimethylmethanamine;pyridine.
Molecular Properties
| Compound Name | N,N-diethylethanamine;N,N-dimethylmethanamine;pyridine |
| PubChem CID | 163946684 |
| Molecular Formula | C14H29N3 |
| Molecular Weight | 239.41 g/mol |
| Exact Mass | 239.24 |
| IUPAC Name | N,N-diethylethanamine;N,N-dimethylmethanamine;pyridine |
| SMILES | CCN(CC)CC.CN(C)C.c1ccncc1 |
| InChI | InChI=1S/C6H15N.C5H5N.C3H9N/c1-4-7(5-2)6-3;1-2-4-6-5-3-1;1-4(2)3/h4-6H2,1-3H3;1-5H;1-3H3 |
| InChIKey | RVSJBLFFPNTPIV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-diethylethanamine;N,N-dimethylmethanamine;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;N,N-dimethylmethanamine;pyridine?
The IUPAC name of N,N-diethylethanamine;N,N-dimethylmethanamine;pyridine (CID 163946684) is N,N-diethylethanamine;N,N-dimethylmethanamine;pyridine.
What is the SMILES notation for N,N-diethylethanamine;N,N-dimethylmethanamine;pyridine?
The canonical SMILES for N,N-diethylethanamine;N,N-dimethylmethanamine;pyridine is CCN(CC)CC.CN(C)C.c1ccncc1.
What is the InChIKey of N,N-diethylethanamine;N,N-dimethylmethanamine;pyridine?
The InChIKey is RVSJBLFFPNTPIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C5H5N.C3H9N/c1-4-7(5-2)6-3;1-2-4-6-5-3-1;1-4(2)3/h4-6H2,1-3H3;1-5H;1-3H3.
What are the key properties of N,N-diethylethanamine;N,N-dimethylmethanamine;pyridine?
N,N-diethylethanamine;N,N-dimethylmethanamine;pyridine has a molecular weight of 239.41 g/mol, XLogP of 2.61, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;N,N-dimethylmethanamine;pyridine is sourced from PubChem (CID 163946684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).