C14H29N3 — CID 163946684
N,N-diethylethanamine;N,N-dimethylmethanamine;pyridine (PubChem CID 163946684) has the molecular formula C14H29N3 and a molecular weight of 239.41 g/mol. Its IUPAC name is N,N-diethylethanamine;N,N-dimethylmethanamine;pyridine.
| Compound Name | N,N-diethylethanamine;N,N-dimethylmethanamine;pyridine |
|---|---|
| PubChem CID | 163946684 |
| Molecular Formula | C14H29N3 |
| Molecular Weight | 239.41 g/mol |
| Exact Mass | 239.24 |
| IUPAC Name | N,N-diethylethanamine;N,N-dimethylmethanamine;pyridine |
| SMILES | CCN(CC)CC.CN(C)C.c1ccncc1 |
| InChI | InChI=1S/C6H15N.C5H5N.C3H9N/c1-4-7(5-2)6-3;1-2-4-6-5-3-1;1-4(2)3/h4-6H2,1-3H3;1-5H;1-3H3 |
| InChIKey | RVSJBLFFPNTPIV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |