C17H28O3 — CID 163947322
2-methylpropyl (E,4S)-4-(1-methylcyclohexyl)-5-oxohex-2-enoate (PubChem CID 163947322) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is 2-methylpropyl (E,4S)-4-(1-methylcyclohexyl)-5-oxohex-2-enoate.
| Compound Name | 2-methylpropyl (E,4S)-4-(1-methylcyclohexyl)-5-oxohex-2-enoate |
|---|---|
| PubChem CID | 163947322 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 2-methylpropyl (E,4S)-4-(1-methylcyclohexyl)-5-oxohex-2-enoate |
| SMILES | CC(=O)[C@@H](/C=C/C(=O)OCC(C)C)C1(C)CCCCC1 |
| InChI | InChI=1S/C17H28O3/c1-13(2)12-20-16(19)9-8-15(14(3)18)17(4)10-6-5-7-11-17/h8-9,13,15H,5-7,10-12H2,1-4H3/b9-8+/t15-/m1/s1 |
| InChIKey | RWGPATJQOVASLO-XVJNWHFHSA-N |
| XLogP | 3.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|