C33H31FO6 — CID 163948408
[3-[3-fluoro-4-[2-(2-methylprop-2-enoyloxy)-2,3-dihydro-1H-inden-5-yl]phenyl]-5-(2-methylprop-2-enoyloxy)phenyl] 2-methylpropanoate (PubChem CID 163948408) has the molecular formula C33H31FO6 and a molecular weight of 542.60 g/mol. Its IUPAC name is [3-[3-fluoro-4-[2-(2-methylprop-2-enoyloxy)-2,3-dihydro-1H-inden-5-yl]phenyl]-5-(2-methylprop-2-enoyloxy)phenyl] 2-methylpropanoate.
| Compound Name | [3-[3-fluoro-4-[2-(2-methylprop-2-enoyloxy)-2,3-dihydro-1H-inden-5-yl]phenyl]-5-(2-methylprop-2-enoyloxy)phenyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 163948408 |
| Molecular Formula | C33H31FO6 |
| Molecular Weight | 542.60 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | [3-[3-fluoro-4-[2-(2-methylprop-2-enoyloxy)-2,3-dihydro-1H-inden-5-yl]phenyl]-5-(2-methylprop-2-enoyloxy)phenyl] 2-methylpropanoate |
| SMILES | C=C(C)C(=O)Oc1cc(OC(=O)C(C)C)cc(-c2ccc(-c3ccc4c(c3)CC(OC(=O)C(=C)C)C4)c(F)c2)c1 |
| InChI | InChI=1S/C33H31FO6/c1-18(2)31(35)38-26-12-21-7-8-23(11-24(21)13-26)29-10-9-22(16-30(29)34)25-14-27(39-32(36)19(3)4)17-28(15-25)40-33(37)20(5)6/h7-11,14-17,20,26H,1,3,12-13H2,2,4-6H3 |
| InChIKey | RXEBKDLDPICVQZ-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.60 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|