C5H14N4 — CID 163948445
N-methyl-N,2-bis(methylamino)ethanimidamide (PubChem CID 163948445) has the molecular formula C5H14N4 and a molecular weight of 130.19 g/mol. Its IUPAC name is N-methyl-N,2-bis(methylamino)ethanimidamide.
| Compound Name | N-methyl-N,2-bis(methylamino)ethanimidamide |
|---|---|
| PubChem CID | 163948445 |
| Molecular Formula | C5H14N4 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.12 |
| IUPAC Name | N-methyl-N,2-bis(methylamino)ethanimidamide |
| SMILES | [H]/N=C(\CNC)N(C)NC |
| InChI | InChI=1S/C5H14N4/c1-7-4-5(6)9(3)8-2/h6-8H,4H2,1-3H3/b6-5+ |
| InChIKey | RXEYXPIBKAIJEU-AATRIKPKSA-N |
| XLogP | -0.75 |
| TPSA | 51.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|