C13H21ClN2O2 — CID 163949957
N-[2-[[(3E)-5-chloro-4-methoxyhexa-1,3,5-trien-2-yl]-methylamino]ethyl]-N-methylacetamide (PubChem CID 163949957) has the molecular formula C13H21ClN2O2 and a molecular weight of 272.78 g/mol. Its IUPAC name is N-[2-[[(3E)-5-chloro-4-methoxyhexa-1,3,5-trien-2-yl]-methylamino]ethyl]-N-methylacetamide.
| Compound Name | N-[2-[[(3E)-5-chloro-4-methoxyhexa-1,3,5-trien-2-yl]-methylamino]ethyl]-N-methylacetamide |
|---|---|
| PubChem CID | 163949957 |
| Molecular Formula | C13H21ClN2O2 |
| Molecular Weight | 272.78 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | N-[2-[[(3E)-5-chloro-4-methoxyhexa-1,3,5-trien-2-yl]-methylamino]ethyl]-N-methylacetamide |
| SMILES | C=C(Cl)/C(=C\C(=C)N(C)CCN(C)C(C)=O)OC |
| InChI | InChI=1S/C13H21ClN2O2/c1-10(9-13(18-6)11(2)14)15(4)7-8-16(5)12(3)17/h9H,1-2,7-8H2,3-6H3/b13-9+ |
| InChIKey | RYLDNJSWYXPFAH-UKTHLTGXSA-N |
| XLogP | 2.19 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.78 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|