C31H39N3O2 — CID 163950956
N-[2-[[(3R)-1-benzylpyrrolidin-3-yl]amino]-2-oxoethyl]-2-(3-phenyl-1-adamantyl)acetamide (PubChem CID 163950956) has the molecular formula C31H39N3O2 and a molecular weight of 485.67 g/mol. Its IUPAC name is N-[2-[[(3R)-1-benzylpyrrolidin-3-yl]amino]-2-oxoethyl]-2-(3-phenyl-1-adamantyl)acetamide.
| Compound Name | N-[2-[[(3R)-1-benzylpyrrolidin-3-yl]amino]-2-oxoethyl]-2-(3-phenyl-1-adamantyl)acetamide |
|---|---|
| PubChem CID | 163950956 |
| Molecular Formula | C31H39N3O2 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | N-[2-[[(3R)-1-benzylpyrrolidin-3-yl]amino]-2-oxoethyl]-2-(3-phenyl-1-adamantyl)acetamide |
| SMILES | O=C(CC12CC3CC(C1)CC(c1ccccc1)(C3)C2)NCC(=O)N[C@@H]1CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C31H39N3O2/c35-28(32-19-29(36)33-27-11-12-34(21-27)20-23-7-3-1-4-8-23)18-30-14-24-13-25(15-30)17-31(16-24,22-30)26-9-5-2-6-10-26/h1-10,24-25,27H,11-22H2,(H,32,35)(H,33,36)/t24?,25?,27-,30?,31?/m1/s1 |
| InChIKey | RZGNAPNWECUIDX-IWIUBBACSA-N |
| XLogP | 4.42 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |