C21H22N4O5S — CID 163952648
5-[4-methoxy-3-[4-(4-nitrophenyl)piperazin-1-yl]sulfinylphenyl]-3-methyl-1,2-oxazole (PubChem CID 163952648) has the molecular formula C21H22N4O5S and a molecular weight of 442.50 g/mol. Its IUPAC name is 5-[4-methoxy-3-[4-(4-nitrophenyl)piperazin-1-yl]sulfinylphenyl]-3-methyl-1,2-oxazole.
| Compound Name | 5-[4-methoxy-3-[4-(4-nitrophenyl)piperazin-1-yl]sulfinylphenyl]-3-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 163952648 |
| Molecular Formula | C21H22N4O5S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 5-[4-methoxy-3-[4-(4-nitrophenyl)piperazin-1-yl]sulfinylphenyl]-3-methyl-1,2-oxazole |
| SMILES | COc1ccc(-c2cc(C)no2)cc1S(=O)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C21H22N4O5S/c1-15-13-20(30-22-15)16-3-8-19(29-2)21(14-16)31(28)24-11-9-23(10-12-24)17-4-6-18(7-5-17)25(26)27/h3-8,13-14H,9-12H2,1-2H3 |
| InChIKey | SAQPLZUQCOJHQI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 101.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|