C21H28O6 — CID 163952656
3-[4-(2-ethyl-2-prop-2-enoyloxybutanoyl)cyclohexa-2,4-dien-1-yl]oxypropyl prop-2-enoate (PubChem CID 163952656) has the molecular formula C21H28O6 and a molecular weight of 376.45 g/mol. Its IUPAC name is 3-[4-(2-ethyl-2-prop-2-enoyloxybutanoyl)cyclohexa-2,4-dien-1-yl]oxypropyl prop-2-enoate.
| Compound Name | 3-[4-(2-ethyl-2-prop-2-enoyloxybutanoyl)cyclohexa-2,4-dien-1-yl]oxypropyl prop-2-enoate |
|---|---|
| PubChem CID | 163952656 |
| Molecular Formula | C21H28O6 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 3-[4-(2-ethyl-2-prop-2-enoyloxybutanoyl)cyclohexa-2,4-dien-1-yl]oxypropyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCOC1C=CC(C(=O)C(CC)(CC)OC(=O)C=C)=CC1 |
| InChI | InChI=1S/C21H28O6/c1-5-18(22)26-15-9-14-25-17-12-10-16(11-13-17)20(24)21(7-3,8-4)27-19(23)6-2/h5-6,10-12,17H,1-2,7-9,13-15H2,3-4H3 |
| InChIKey | SAQUNIOEUFUKJI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|