About 2-[butyl(oxido)amino]ethyl 4-hydroxyundecanoate
2-[butyl(oxido)amino]ethyl 4-hydroxyundecanoate (PubChem CID 163953106) has the molecular formula C17H34NO4-
and a molecular weight of 316.46 g/mol. Its IUPAC name is 2-[butyl(oxido)amino]ethyl 4-hydroxyundecanoate.
Molecular Properties
| Compound Name | 2-[butyl(oxido)amino]ethyl 4-hydroxyundecanoate |
| PubChem CID | 163953106 |
| Molecular Formula | C17H34NO4- |
| Molecular Weight | 316.46 g/mol |
| Exact Mass | 316.25 |
| IUPAC Name | 2-[butyl(oxido)amino]ethyl 4-hydroxyundecanoate |
| SMILES | CCCCCCCC(O)CCC(=O)OCCN([O-])CCCC |
| InChI | InChI=1S/C17H34NO4/c1-3-5-7-8-9-10-16(19)11-12-17(20)22-15-14-18(21)13-6-4-2/h16,19H,3-15H2,1-2H3/q-1 |
| InChIKey | QIVJKGOFKMNIPL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.46 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[butyl(oxido)amino]ethyl 4-hydroxyundecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[butyl(oxido)amino]ethyl 4-hydroxyundecanoate?
The IUPAC name of 2-[butyl(oxido)amino]ethyl 4-hydroxyundecanoate (CID 163953106) is 2-[butyl(oxido)amino]ethyl 4-hydroxyundecanoate.
What is the SMILES notation for 2-[butyl(oxido)amino]ethyl 4-hydroxyundecanoate?
The canonical SMILES for 2-[butyl(oxido)amino]ethyl 4-hydroxyundecanoate is CCCCCCCC(O)CCC(=O)OCCN([O-])CCCC.
What is the InChIKey of 2-[butyl(oxido)amino]ethyl 4-hydroxyundecanoate?
The InChIKey is QIVJKGOFKMNIPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34NO4/c1-3-5-7-8-9-10-16(19)11-12-17(20)22-15-14-18(21)13-6-4-2/h16,19H,3-15H2,1-2H3/q-1.
What are the key properties of 2-[butyl(oxido)amino]ethyl 4-hydroxyundecanoate?
2-[butyl(oxido)amino]ethyl 4-hydroxyundecanoate has a molecular weight of 316.46 g/mol, XLogP of 3.63, 15 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[butyl(oxido)amino]ethyl 4-hydroxyundecanoate is sourced from PubChem (CID 163953106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).