C7H9NOS — CID 163953936
3a,4,7,7a-tetrahydro-3H-1,3-benzoxazole-2-thione (PubChem CID 163953936) has the molecular formula C7H9NOS and a molecular weight of 155.22 g/mol. Its IUPAC name is 3a,4,7,7a-tetrahydro-3H-1,3-benzoxazole-2-thione.
| Compound Name | 3a,4,7,7a-tetrahydro-3H-1,3-benzoxazole-2-thione |
|---|---|
| PubChem CID | 163953936 |
| Molecular Formula | C7H9NOS |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.04 |
| IUPAC Name | 3a,4,7,7a-tetrahydro-3H-1,3-benzoxazole-2-thione |
| SMILES | S=C1NC2CC=CCC2O1 |
| InChI | InChI=1S/C7H9NOS/c10-7-8-5-3-1-2-4-6(5)9-7/h1-2,5-6H,3-4H2,(H,8,10) |
| InChIKey | SBSDALGVGDBGKE-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|